C16H21ClN3O2+ — CID 7337159
(4S)-1-(4-chlorophenyl)-4-(4-methylpiperazin-4-ium-1-carbonyl)pyrrolidin-2-one (PubChem CID 7337159) has the molecular formula C16H21ClN3O2+ and a molecular weight of 322.82 g/mol. Its IUPAC name is (4S)-1-(4-chlorophenyl)-4-(4-methylpiperazin-4-ium-1-carbonyl)pyrrolidin-2-one.
| Compound Name | (4S)-1-(4-chlorophenyl)-4-(4-methylpiperazin-4-ium-1-carbonyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 7337159 |
| Molecular Formula | C16H21ClN3O2+ |
| Molecular Weight | 322.82 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | (4S)-1-(4-chlorophenyl)-4-(4-methylpiperazin-4-ium-1-carbonyl)pyrrolidin-2-one |
| SMILES | C[NH+]1CCN(C(=O)[C@H]2CC(=O)N(c3ccc(Cl)cc3)C2)CC1 |
| InChI | InChI=1S/C16H20ClN3O2/c1-18-6-8-19(9-7-18)16(22)12-10-15(21)20(11-12)14-4-2-13(17)3-5-14/h2-5,12H,6-11H2,1H3/p+1/t12-/m0/s1 |
| InChIKey | UXLHJMOISNDSBH-LBPRGKRZSA-O |
| XLogP | 0.05 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.82 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |