About 5-(4-chlorophenyl)bicyclo[2.1.0]pentane;methyl propanoate
5-(4-chlorophenyl)bicyclo[2.1.0]pentane;methyl propanoate (PubChem CID 174373098) has the molecular formula C15H19ClO2
and a molecular weight of 266.77 g/mol. Its IUPAC name is 5-(4-chlorophenyl)bicyclo[2.1.0]pentane;methyl propanoate.
Molecular Properties
| Compound Name | 5-(4-chlorophenyl)bicyclo[2.1.0]pentane;methyl propanoate |
| PubChem CID | 174373098 |
| Molecular Formula | C15H19ClO2 |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 5-(4-chlorophenyl)bicyclo[2.1.0]pentane;methyl propanoate |
| SMILES | CCC(=O)OC.Clc1ccc(C2C3CCC32)cc1 |
| InChI | InChI=1S/C11H11Cl.C4H8O2/c12-8-3-1-7(2-4-8)11-9-5-6-10(9)11;1-3-4(5)6-2/h1-4,9-11H,5-6H2;3H2,1-2H3 |
| InChIKey | YFAXNQGDYFFUOG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(4-chlorophenyl)bicyclo[2.1.0]pentane;methyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chlorophenyl)bicyclo[2.1.0]pentane;methyl propanoate?
The IUPAC name of 5-(4-chlorophenyl)bicyclo[2.1.0]pentane;methyl propanoate (CID 174373098) is 5-(4-chlorophenyl)bicyclo[2.1.0]pentane;methyl propanoate.
What is the SMILES notation for 5-(4-chlorophenyl)bicyclo[2.1.0]pentane;methyl propanoate?
The canonical SMILES for 5-(4-chlorophenyl)bicyclo[2.1.0]pentane;methyl propanoate is CCC(=O)OC.Clc1ccc(C2C3CCC32)cc1.
What is the InChIKey of 5-(4-chlorophenyl)bicyclo[2.1.0]pentane;methyl propanoate?
The InChIKey is YFAXNQGDYFFUOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11Cl.C4H8O2/c12-8-3-1-7(2-4-8)11-9-5-6-10(9)11;1-3-4(5)6-2/h1-4,9-11H,5-6H2;3H2,1-2H3.
What are the key properties of 5-(4-chlorophenyl)bicyclo[2.1.0]pentane;methyl propanoate?
5-(4-chlorophenyl)bicyclo[2.1.0]pentane;methyl propanoate has a molecular weight of 266.77 g/mol, XLogP of 4.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chlorophenyl)bicyclo[2.1.0]pentane;methyl propanoate is sourced from PubChem (CID 174373098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).