C23H28O5 — CID 139629207
5-[(4-methoxyphenyl)methyl]-2-[4-(2-prop-2-enoxyethoxy)phenyl]-1,3-dioxane (PubChem CID 139629207) has the molecular formula C23H28O5 and a molecular weight of 384.47 g/mol. Its IUPAC name is 5-[(4-methoxyphenyl)methyl]-2-[4-(2-prop-2-enoxyethoxy)phenyl]-1,3-dioxane.
| Compound Name | 5-[(4-methoxyphenyl)methyl]-2-[4-(2-prop-2-enoxyethoxy)phenyl]-1,3-dioxane |
|---|---|
| PubChem CID | 139629207 |
| Molecular Formula | C23H28O5 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 5-[(4-methoxyphenyl)methyl]-2-[4-(2-prop-2-enoxyethoxy)phenyl]-1,3-dioxane |
| SMILES | C=CCOCCOc1ccc(C2OCC(Cc3ccc(OC)cc3)CO2)cc1 |
| InChI | InChI=1S/C23H28O5/c1-3-12-25-13-14-26-22-10-6-20(7-11-22)23-27-16-19(17-28-23)15-18-4-8-21(24-2)9-5-18/h3-11,19,23H,1,12-17H2,2H3 |
| InChIKey | QWKOCNZXDJHXTA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|