C15H18O2 — CID 10728184
(2R,6R)-2-(4-methoxyphenyl)-6-prop-2-enyl-3,6-dihydro-2H-pyran (PubChem CID 10728184) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is (2R,6R)-2-(4-methoxyphenyl)-6-prop-2-enyl-3,6-dihydro-2H-pyran.
| Compound Name | (2R,6R)-2-(4-methoxyphenyl)-6-prop-2-enyl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 10728184 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (2R,6R)-2-(4-methoxyphenyl)-6-prop-2-enyl-3,6-dihydro-2H-pyran |
| SMILES | C=CC[C@@H]1C=CC[C@H](c2ccc(OC)cc2)O1 |
| InChI | InChI=1S/C15H18O2/c1-3-5-14-6-4-7-15(17-14)12-8-10-13(16-2)11-9-12/h3-4,6,8-11,14-15H,1,5,7H2,2H3/t14-,15-/m1/s1 |
| InChIKey | HHECHRAANPFZQO-HUUCEWRRSA-N |
| XLogP | 3.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|