C24H30O6 — CID 11943663
(4aS,6S,10bS)-8,9-dimethoxy-6-(3,4,5-trimethoxyphenyl)-2,3,4,4a,6,10b-hexahydro-1H-benzo[c]chromene (PubChem CID 11943663) has the molecular formula C24H30O6 and a molecular weight of 414.50 g/mol. Its IUPAC name is (4aS,6S,10bS)-8,9-dimethoxy-6-(3,4,5-trimethoxyphenyl)-2,3,4,4a,6,10b-hexahydro-1H-benzo[c]chromene.
| Compound Name | (4aS,6S,10bS)-8,9-dimethoxy-6-(3,4,5-trimethoxyphenyl)-2,3,4,4a,6,10b-hexahydro-1H-benzo[c]chromene |
|---|---|
| PubChem CID | 11943663 |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | (4aS,6S,10bS)-8,9-dimethoxy-6-(3,4,5-trimethoxyphenyl)-2,3,4,4a,6,10b-hexahydro-1H-benzo[c]chromene |
| SMILES | COc1cc2c(cc1OC)[C@@H]1CCCC[C@@H]1O[C@H]2c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C24H30O6/c1-25-19-12-16-15-8-6-7-9-18(15)30-23(17(16)13-20(19)26-2)14-10-21(27-3)24(29-5)22(11-14)28-4/h10-13,15,18,23H,6-9H2,1-5H3/t15-,18-,23-/m0/s1 |
| InChIKey | MIDMTBZLZSFHQP-WIRVKHDMSA-N |
| XLogP | 4.88 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |