C21H25NO3 — CID 40823514
3-[(4aS,6R,10bS)-7,10-dimethoxy-2,3,4,4a,6,10b-hexahydro-1H-benzo[c]chromen-6-yl]aniline (PubChem CID 40823514) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is 3-[(4aS,6R,10bS)-7,10-dimethoxy-2,3,4,4a,6,10b-hexahydro-1H-benzo[c]chromen-6-yl]aniline.
| Compound Name | 3-[(4aS,6R,10bS)-7,10-dimethoxy-2,3,4,4a,6,10b-hexahydro-1H-benzo[c]chromen-6-yl]aniline |
|---|---|
| PubChem CID | 40823514 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 3-[(4aS,6R,10bS)-7,10-dimethoxy-2,3,4,4a,6,10b-hexahydro-1H-benzo[c]chromen-6-yl]aniline |
| SMILES | COc1ccc(OC)c2c1[C@@H](c1cccc(N)c1)O[C@H]1CCCC[C@@H]21 |
| InChI | InChI=1S/C21H25NO3/c1-23-17-10-11-18(24-2)20-19(17)15-8-3-4-9-16(15)25-21(20)13-6-5-7-14(22)12-13/h5-7,10-12,15-16,21H,3-4,8-9,22H2,1-2H3/t15-,16+,21-/m1/s1 |
| InChIKey | BVMLGIDRODFNIZ-VWKPWSFCSA-N |
| XLogP | 4.43 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|