C26H31NO6 — CID 124763038
methyl 4-[3-[(4aS,6S,10bS)-7,10-dimethoxy-2,3,4,4a,6,10b-hexahydro-1H-benzo[c]chromen-6-yl]anilino]-4-oxobutanoate (PubChem CID 124763038) has the molecular formula C26H31NO6 and a molecular weight of 453.54 g/mol. Its IUPAC name is methyl 4-[3-[(4aS,6S,10bS)-7,10-dimethoxy-2,3,4,4a,6,10b-hexahydro-1H-benzo[c]chromen-6-yl]anilino]-4-oxobutanoate.
| Compound Name | methyl 4-[3-[(4aS,6S,10bS)-7,10-dimethoxy-2,3,4,4a,6,10b-hexahydro-1H-benzo[c]chromen-6-yl]anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 124763038 |
| Molecular Formula | C26H31NO6 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | methyl 4-[3-[(4aS,6S,10bS)-7,10-dimethoxy-2,3,4,4a,6,10b-hexahydro-1H-benzo[c]chromen-6-yl]anilino]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)Nc1cccc([C@@H]2O[C@H]3CCCC[C@H]3c3c(OC)ccc(OC)c32)c1 |
| InChI | InChI=1S/C26H31NO6/c1-30-20-11-12-21(31-2)25-24(20)18-9-4-5-10-19(18)33-26(25)16-7-6-8-17(15-16)27-22(28)13-14-23(29)32-3/h6-8,11-12,15,18-19,26H,4-5,9-10,13-14H2,1-3H3,(H,27,28)/t18-,19+,26+/m1/s1 |
| InChIKey | PSPVHRSCWDUXJW-MVYHEMRASA-N |
| XLogP | 4.74 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |