C27H33NO4 — CID 124762887
N-[3-[(4aS,6S,10bS)-7,10-dimethoxy-2,3,4,4a,6,10b-hexahydro-1H-benzo[c]chromen-6-yl]phenyl]cyclopentanecarboxamide (PubChem CID 124762887) has the molecular formula C27H33NO4 and a molecular weight of 435.56 g/mol. Its IUPAC name is N-[3-[(4aS,6S,10bS)-7,10-dimethoxy-2,3,4,4a,6,10b-hexahydro-1H-benzo[c]chromen-6-yl]phenyl]cyclopentanecarboxamide.
| Compound Name | N-[3-[(4aS,6S,10bS)-7,10-dimethoxy-2,3,4,4a,6,10b-hexahydro-1H-benzo[c]chromen-6-yl]phenyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 124762887 |
| Molecular Formula | C27H33NO4 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | N-[3-[(4aS,6S,10bS)-7,10-dimethoxy-2,3,4,4a,6,10b-hexahydro-1H-benzo[c]chromen-6-yl]phenyl]cyclopentanecarboxamide |
| SMILES | COc1ccc(OC)c2c1[C@H](c1cccc(NC(=O)C3CCCC3)c1)O[C@H]1CCCC[C@@H]21 |
| InChI | InChI=1S/C27H33NO4/c1-30-22-14-15-23(31-2)25-24(22)20-12-5-6-13-21(20)32-26(25)18-10-7-11-19(16-18)28-27(29)17-8-3-4-9-17/h7,10-11,14-17,20-21,26H,3-6,8-9,12-13H2,1-2H3,(H,28,29)/t20-,21+,26+/m1/s1 |
| InChIKey | GXAPBFIBEHYHFO-SWYRRKHMSA-N |
| XLogP | 5.98 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |