C30H33NO5 — CID 51508110
N-[3-[(4aS,6S,10bS)-7,10-dimethoxy-2,3,4,4a,6,10b-hexahydro-1H-benzo[c]chromen-6-yl]phenyl]-2-methoxy-3-methylbenzamide (PubChem CID 51508110) has the molecular formula C30H33NO5 and a molecular weight of 487.60 g/mol. Its IUPAC name is N-[3-[(4aS,6S,10bS)-7,10-dimethoxy-2,3,4,4a,6,10b-hexahydro-1H-benzo[c]chromen-6-yl]phenyl]-2-methoxy-3-methylbenzamide.
| Compound Name | N-[3-[(4aS,6S,10bS)-7,10-dimethoxy-2,3,4,4a,6,10b-hexahydro-1H-benzo[c]chromen-6-yl]phenyl]-2-methoxy-3-methylbenzamide |
|---|---|
| PubChem CID | 51508110 |
| Molecular Formula | C30H33NO5 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | N-[3-[(4aS,6S,10bS)-7,10-dimethoxy-2,3,4,4a,6,10b-hexahydro-1H-benzo[c]chromen-6-yl]phenyl]-2-methoxy-3-methylbenzamide |
| SMILES | COc1ccc(OC)c2c1[C@H](c1cccc(NC(=O)c3cccc(C)c3OC)c1)O[C@H]1CCCC[C@@H]21 |
| InChI | InChI=1S/C30H33NO5/c1-18-9-7-13-22(28(18)35-4)30(32)31-20-11-8-10-19(17-20)29-27-25(34-3)16-15-24(33-2)26(27)21-12-5-6-14-23(21)36-29/h7-11,13,15-17,21,23,29H,5-6,12,14H2,1-4H3,(H,31,32)/t21-,23+,29+/m1/s1 |
| InChIKey | ZVCZEKJNLGZTLU-LUICLMBMSA-N |
| XLogP | 6.42 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |