C24H30BrNO3 — CID 70624713
(4aS,10bS)-1-(cyclopropylmethyl)-8,9-dimethoxy-6-phenyl-2,3,4,4a,6,10b-hexahydroisochromeno[4,3-b]pyridine;hydrobromide (PubChem CID 70624713) has the molecular formula C24H30BrNO3 and a molecular weight of 460.41 g/mol. Its IUPAC name is (4aS,10bS)-1-(cyclopropylmethyl)-8,9-dimethoxy-6-phenyl-2,3,4,4a,6,10b-hexahydroisochromeno[4,3-b]pyridine;hydrobromide.
| Compound Name | (4aS,10bS)-1-(cyclopropylmethyl)-8,9-dimethoxy-6-phenyl-2,3,4,4a,6,10b-hexahydroisochromeno[4,3-b]pyridine;hydrobromide |
|---|---|
| PubChem CID | 70624713 |
| Molecular Formula | C24H30BrNO3 |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | (4aS,10bS)-1-(cyclopropylmethyl)-8,9-dimethoxy-6-phenyl-2,3,4,4a,6,10b-hexahydroisochromeno[4,3-b]pyridine;hydrobromide |
| SMILES | Br.COc1cc2c(cc1OC)[C@H]1[C@H](CCCN1CC1CC1)OC2c1ccccc1 |
| InChI | InChI=1S/C24H29NO3.BrH/c1-26-21-13-18-19(14-22(21)27-2)24(17-7-4-3-5-8-17)28-20-9-6-12-25(23(18)20)15-16-10-11-16;/h3-5,7-8,13-14,16,20,23-24H,6,9-12,15H2,1-2H3;1H/t20-,23-,24?;/m0./s1 |
| InChIKey | HOSRJUHHZVZVCX-RWEWAFIKSA-N |
| XLogP | 5.32 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |