C25H31N3O — CID 70169969
(2S,3S)-1-[[5-(2,5-dimethylpyrrol-1-yl)-2-methoxyphenyl]methyl]-2-phenylpiperidin-3-amine (PubChem CID 70169969) has the molecular formula C25H31N3O and a molecular weight of 389.54 g/mol. Its IUPAC name is (2S,3S)-1-[[5-(2,5-dimethylpyrrol-1-yl)-2-methoxyphenyl]methyl]-2-phenylpiperidin-3-amine.
| Compound Name | (2S,3S)-1-[[5-(2,5-dimethylpyrrol-1-yl)-2-methoxyphenyl]methyl]-2-phenylpiperidin-3-amine |
|---|---|
| PubChem CID | 70169969 |
| Molecular Formula | C25H31N3O |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | (2S,3S)-1-[[5-(2,5-dimethylpyrrol-1-yl)-2-methoxyphenyl]methyl]-2-phenylpiperidin-3-amine |
| SMILES | COc1ccc(-n2c(C)ccc2C)cc1CN1CCC[C@H](N)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C25H31N3O/c1-18-11-12-19(2)28(18)22-13-14-24(29-3)21(16-22)17-27-15-7-10-23(26)25(27)20-8-5-4-6-9-20/h4-6,8-9,11-14,16,23,25H,7,10,15,17,26H2,1-3H3/t23-,25-/m0/s1 |
| InChIKey | OBHZZOOJFATIPI-ZCYQVOJMSA-N |
| XLogP | 4.77 |
| TPSA | 43.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|