C24H28O2 — CID 66652030
6-methoxy-10-(4-methoxyphenyl)-2,2-dimethyl-3,4,4a,10a-tetrahydro-1H-phenanthrene (PubChem CID 66652030) has the molecular formula C24H28O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is 6-methoxy-10-(4-methoxyphenyl)-2,2-dimethyl-3,4,4a,10a-tetrahydro-1H-phenanthrene.
| Compound Name | 6-methoxy-10-(4-methoxyphenyl)-2,2-dimethyl-3,4,4a,10a-tetrahydro-1H-phenanthrene |
|---|---|
| PubChem CID | 66652030 |
| Molecular Formula | C24H28O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 6-methoxy-10-(4-methoxyphenyl)-2,2-dimethyl-3,4,4a,10a-tetrahydro-1H-phenanthrene |
| SMILES | COc1ccc(C2=Cc3ccc(OC)cc3C3CCC(C)(C)CC23)cc1 |
| InChI | InChI=1S/C24H28O2/c1-24(2)12-11-20-22-14-19(26-4)10-7-17(22)13-21(23(20)15-24)16-5-8-18(25-3)9-6-16/h5-10,13-14,20,23H,11-12,15H2,1-4H3 |
| InChIKey | CVVWEBSKFNYJOK-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|