C21H24O3 — CID 59504338
(3aS,9bR)-4-(4-methoxy-3-methylphenyl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalene-5,6-diol (PubChem CID 59504338) has the molecular formula C21H24O3 and a molecular weight of 324.42 g/mol. Its IUPAC name is (3aS,9bR)-4-(4-methoxy-3-methylphenyl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalene-5,6-diol.
| Compound Name | (3aS,9bR)-4-(4-methoxy-3-methylphenyl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalene-5,6-diol |
|---|---|
| PubChem CID | 59504338 |
| Molecular Formula | C21H24O3 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | (3aS,9bR)-4-(4-methoxy-3-methylphenyl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalene-5,6-diol |
| SMILES | COc1ccc(C2C(O)c3c(O)cccc3[C@@H]3CCC[C@H]23)cc1C |
| InChI | InChI=1S/C21H24O3/c1-12-11-13(9-10-18(12)24-2)19-15-6-3-5-14(15)16-7-4-8-17(22)20(16)21(19)23/h4,7-11,14-15,19,21-23H,3,5-6H2,1-2H3/t14-,15+,19?,21?/m1/s1 |
| InChIKey | VKGHPYFRCNCEEZ-SPSKMVEZSA-N |
| XLogP | 4.42 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |