C24H31NO — CID 166876938
(1R,9S,15S)-4-methoxy-N-(2-phenylethyl)tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trien-15-amine (PubChem CID 166876938) has the molecular formula C24H31NO and a molecular weight of 349.52 g/mol. Its IUPAC name is (1R,9S,15S)-4-methoxy-N-(2-phenylethyl)tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trien-15-amine.
| Compound Name | (1R,9S,15S)-4-methoxy-N-(2-phenylethyl)tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trien-15-amine |
|---|---|
| PubChem CID | 166876938 |
| Molecular Formula | C24H31NO |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | (1R,9S,15S)-4-methoxy-N-(2-phenylethyl)tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trien-15-amine |
| SMILES | COc1ccc2c(c1)[C@H]1CCCCC[C@@H](C2)[C@@H]1NCCc1ccccc1 |
| InChI | InChI=1S/C24H31NO/c1-26-21-13-12-19-16-20-10-6-3-7-11-22(23(19)17-21)24(20)25-15-14-18-8-4-2-5-9-18/h2,4-5,8-9,12-13,17,20,22,24-25H,3,6-7,10-11,14-16H2,1H3/t20-,22+,24-/m0/s1 |
| InChIKey | MGMGTGNETOHJHN-FJIJXJHWSA-N |
| XLogP | 5.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |