C16H24N2O4 — CID 142993285
formic acid;methanol;6-methoxy-1,3-dimethyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 142993285) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is formic acid;methanol;6-methoxy-1,3-dimethyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | formic acid;methanol;6-methoxy-1,3-dimethyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 142993285 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | formic acid;methanol;6-methoxy-1,3-dimethyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | CO.COc1ccc2[nH]c3c(c2c1)CC(C)NC3C.O=CO |
| InChI | InChI=1S/C14H18N2O.CH2O2.CH4O/c1-8-6-12-11-7-10(17-3)4-5-13(11)16-14(12)9(2)15-8;2-1-3;1-2/h4-5,7-9,15-16H,6H2,1-3H3;1H,(H,2,3);2H,1H3 |
| InChIKey | BFBZSFMYXFFICO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 94.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|