C14H18N2S — CID 125482199
(1R,3S)-1,3-dimethyl-6-methylsulfanyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 125482199) has the molecular formula C14H18N2S and a molecular weight of 246.38 g/mol. Its IUPAC name is (1R,3S)-1,3-dimethyl-6-methylsulfanyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | (1R,3S)-1,3-dimethyl-6-methylsulfanyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 125482199 |
| Molecular Formula | C14H18N2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | (1R,3S)-1,3-dimethyl-6-methylsulfanyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | CSc1ccc2[nH]c3c(c2c1)C[C@H](C)N[C@@H]3C |
| InChI | InChI=1S/C14H18N2S/c1-8-6-12-11-7-10(17-3)4-5-13(11)16-14(12)9(2)15-8/h4-5,7-9,15-16H,6H2,1-3H3/t8-,9+/m0/s1 |
| InChIKey | HXKWUSWJDWAUEK-DTWKUNHWSA-N |
| XLogP | 3.48 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|