C13H11N2O4- — CID 6997617
(1R,3R)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-1,3-dicarboxylate (PubChem CID 6997617) has the molecular formula C13H11N2O4- and a molecular weight of 259.24 g/mol. Its IUPAC name is (1R,3R)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-1,3-dicarboxylate.
| Compound Name | (1R,3R)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-1,3-dicarboxylate |
|---|---|
| PubChem CID | 6997617 |
| Molecular Formula | C13H11N2O4- |
| Molecular Weight | 259.24 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | (1R,3R)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-1,3-dicarboxylate |
| SMILES | O=C([O-])[C@H]1Cc2c([nH]c3ccccc23)[C@H](C(=O)[O-])[NH2+]1 |
| InChI | InChI=1S/C13H12N2O4/c16-12(17)9-5-7-6-3-1-2-4-8(6)14-10(7)11(15-9)13(18)19/h1-4,9,11,14-15H,5H2,(H,16,17)(H,18,19)/p-1/t9-,11-/m1/s1 |
| InChIKey | ZWMZDKZTZLGVRQ-MWLCHTKSSA-M |
| XLogP | -2.80 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.24 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|