C18H15BrN2O3 — CID 7076242
(1S,3S)-1-(5-bromo-2-hydroxyphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-3-carboxylate (PubChem CID 7076242) has the molecular formula C18H15BrN2O3 and a molecular weight of 387.23 g/mol. Its IUPAC name is (1S,3S)-1-(5-bromo-2-hydroxyphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-3-carboxylate.
| Compound Name | (1S,3S)-1-(5-bromo-2-hydroxyphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-3-carboxylate |
|---|---|
| PubChem CID | 7076242 |
| Molecular Formula | C18H15BrN2O3 |
| Molecular Weight | 387.23 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | (1S,3S)-1-(5-bromo-2-hydroxyphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium-3-carboxylate |
| SMILES | O=C([O-])[C@@H]1Cc2c([nH]c3ccccc23)[C@H](c2cc(Br)ccc2O)[NH2+]1 |
| InChI | InChI=1S/C18H15BrN2O3/c19-9-5-6-15(22)12(7-9)17-16-11(8-14(21-17)18(23)24)10-3-1-2-4-13(10)20-16/h1-7,14,17,20-22H,8H2,(H,23,24)/t14-,17-/m0/s1 |
| InChIKey | VKCHTYMIWIYDGN-YOEHRIQHSA-N |
| XLogP | 0.96 |
| TPSA | 92.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.23 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|