C20H22ClN3O — CID 162011668
N-[4-(6-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)phenyl]acetamide;methane (PubChem CID 162011668) has the molecular formula C20H22ClN3O and a molecular weight of 355.87 g/mol. Its IUPAC name is N-[4-(6-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)phenyl]acetamide;methane.
| Compound Name | N-[4-(6-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)phenyl]acetamide;methane |
|---|---|
| PubChem CID | 162011668 |
| Molecular Formula | C20H22ClN3O |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | N-[4-(6-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)phenyl]acetamide;methane |
| SMILES | C.CC(=O)Nc1ccc(C2NCCc3c2[nH]c2ccc(Cl)cc32)cc1 |
| InChI | InChI=1S/C19H18ClN3O.CH4/c1-11(24)22-14-5-2-12(3-6-14)18-19-15(8-9-21-18)16-10-13(20)4-7-17(16)23-19;/h2-7,10,18,21,23H,8-9H2,1H3,(H,22,24);1H4 |
| InChIKey | YTOGFCQPVOZJKD-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|