C18H15BrN2O — CID 145496010
6-bromo-1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbaldehyde (PubChem CID 145496010) has the molecular formula C18H15BrN2O and a molecular weight of 355.24 g/mol. Its IUPAC name is 6-bromo-1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbaldehyde.
| Compound Name | 6-bromo-1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbaldehyde |
|---|---|
| PubChem CID | 145496010 |
| Molecular Formula | C18H15BrN2O |
| Molecular Weight | 355.24 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 6-bromo-1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbaldehyde |
| SMILES | O=CN1CCc2c([nH]c3ccc(Br)cc23)C1c1ccccc1 |
| InChI | InChI=1S/C18H15BrN2O/c19-13-6-7-16-15(10-13)14-8-9-21(11-22)18(17(14)20-16)12-4-2-1-3-5-12/h1-7,10-11,18,20H,8-9H2 |
| InChIKey | WYZYJFRSDXHILR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.24 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|