C22H24BrN3O3 — CID 59597082
1-[6-bromo-1-(3-hydroxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-(2-methoxyethylamino)ethanone (PubChem CID 59597082) has the molecular formula C22H24BrN3O3 and a molecular weight of 458.36 g/mol. Its IUPAC name is 1-[6-bromo-1-(3-hydroxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-(2-methoxyethylamino)ethanone.
| Compound Name | 1-[6-bromo-1-(3-hydroxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-(2-methoxyethylamino)ethanone |
|---|---|
| PubChem CID | 59597082 |
| Molecular Formula | C22H24BrN3O3 |
| Molecular Weight | 458.36 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | 1-[6-bromo-1-(3-hydroxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-(2-methoxyethylamino)ethanone |
| SMILES | COCCNCC(=O)N1CCc2c([nH]c3ccc(Br)cc23)C1c1cccc(O)c1 |
| InChI | InChI=1S/C22H24BrN3O3/c1-29-10-8-24-13-20(28)26-9-7-17-18-12-15(23)5-6-19(18)25-21(17)22(26)14-3-2-4-16(27)11-14/h2-6,11-12,22,24-25,27H,7-10,13H2,1H3 |
| InChIKey | UHNSYUJRWOSMMQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|