C22H25N3O2 — CID 59597106
3-amino-1-[1-(3-hydroxyphenyl)-6,8-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propan-1-one (PubChem CID 59597106) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 3-amino-1-[1-(3-hydroxyphenyl)-6,8-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propan-1-one.
| Compound Name | 3-amino-1-[1-(3-hydroxyphenyl)-6,8-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propan-1-one |
|---|---|
| PubChem CID | 59597106 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 3-amino-1-[1-(3-hydroxyphenyl)-6,8-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propan-1-one |
| SMILES | Cc1cc(C)c2[nH]c3c(c2c1)CCN(C(=O)CCN)C3c1cccc(O)c1 |
| InChI | InChI=1S/C22H25N3O2/c1-13-10-14(2)20-18(11-13)17-7-9-25(19(27)6-8-23)22(21(17)24-20)15-4-3-5-16(26)12-15/h3-5,10-12,22,24,26H,6-9,23H2,1-2H3 |
| InChIKey | LGCFASSCWWIFNU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|