C28H37BrN4O2 — CID 143535879
6-bromo-1-[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbaldehyde;methoxyethane (PubChem CID 143535879) has the molecular formula C28H37BrN4O2 and a molecular weight of 541.53 g/mol. Its IUPAC name is 6-bromo-1-[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbaldehyde;methoxyethane.
| Compound Name | 6-bromo-1-[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbaldehyde;methoxyethane |
|---|---|
| PubChem CID | 143535879 |
| Molecular Formula | C28H37BrN4O2 |
| Molecular Weight | 541.53 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | 6-bromo-1-[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbaldehyde;methoxyethane |
| SMILES | CCOC.CN1CCCN(Cc2ccc(C3c4[nH]c5ccc(Br)cc5c4CCN3C=O)cc2)CC1 |
| InChI | InChI=1S/C25H29BrN4O.C3H8O/c1-28-10-2-11-29(14-13-28)16-18-3-5-19(6-4-18)25-24-21(9-12-30(25)17-31)22-15-20(26)7-8-23(22)27-24;1-3-4-2/h3-8,15,17,25,27H,2,9-14,16H2,1H3;3H2,1-2H3 |
| InChIKey | OSQDCHYGYLCSFV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 51.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.53 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|