C31H45N3O5 — CID 143535846
ethane;1-[4-(2-hydroxy-3-morpholin-4-ylpropoxy)phenyl]-6-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbaldehyde;methoxyethane (PubChem CID 143535846) has the molecular formula C31H45N3O5 and a molecular weight of 539.72 g/mol. Its IUPAC name is ethane;1-[4-(2-hydroxy-3-morpholin-4-ylpropoxy)phenyl]-6-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbaldehyde;methoxyethane.
| Compound Name | ethane;1-[4-(2-hydroxy-3-morpholin-4-ylpropoxy)phenyl]-6-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbaldehyde;methoxyethane |
|---|---|
| PubChem CID | 143535846 |
| Molecular Formula | C31H45N3O5 |
| Molecular Weight | 539.72 g/mol |
| Exact Mass | 539.34 |
| IUPAC Name | ethane;1-[4-(2-hydroxy-3-morpholin-4-ylpropoxy)phenyl]-6-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbaldehyde;methoxyethane |
| SMILES | CC.CCOC.Cc1ccc2[nH]c3c(c2c1)CCN(C=O)C3c1ccc(OCC(O)CN2CCOCC2)cc1 |
| InChI | InChI=1S/C26H31N3O4.C3H8O.C2H6/c1-18-2-7-24-23(14-18)22-8-9-29(17-30)26(25(22)27-24)19-3-5-21(6-4-19)33-16-20(31)15-28-10-12-32-13-11-28;1-3-4-2;1-2/h2-7,14,17,20,26-27,31H,8-13,15-16H2,1H3;3H2,1-2H3;1-2H3 |
| InChIKey | LCHRSGPNIJHNNC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 87.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.72 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|