C26H35BrN4O2 — CID 143312559
4-(2-amino-5-bromophenyl)-6-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-3,6-dihydro-2H-pyridine-1-carbaldehyde;ethanol (PubChem CID 143312559) has the molecular formula C26H35BrN4O2 and a molecular weight of 515.50 g/mol. Its IUPAC name is 4-(2-amino-5-bromophenyl)-6-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-3,6-dihydro-2H-pyridine-1-carbaldehyde;ethanol.
| Compound Name | 4-(2-amino-5-bromophenyl)-6-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-3,6-dihydro-2H-pyridine-1-carbaldehyde;ethanol |
|---|---|
| PubChem CID | 143312559 |
| Molecular Formula | C26H35BrN4O2 |
| Molecular Weight | 515.50 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | 4-(2-amino-5-bromophenyl)-6-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-3,6-dihydro-2H-pyridine-1-carbaldehyde;ethanol |
| SMILES | CCO.CN1CCN(Cc2ccc(C3C=C(c4cc(Br)ccc4N)CCN3C=O)cc2)CC1 |
| InChI | InChI=1S/C24H29BrN4O.C2H6O/c1-27-10-12-28(13-11-27)16-18-2-4-19(5-3-18)24-14-20(8-9-29(24)17-30)22-15-21(25)6-7-23(22)26;1-2-3/h2-7,14-15,17,24H,8-13,16,26H2,1H3;3H,2H2,1H3 |
| InChIKey | DXFAXFGRRNSHMY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 73.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|