C27H26BrClN2O4 — CID 143536004
1-chloro-4-methoxybenzene;methyl 4-[4-(2-amino-5-bromophenyl)-1-formyl-3,6-dihydro-2H-pyridin-6-yl]benzoate (PubChem CID 143536004) has the molecular formula C27H26BrClN2O4 and a molecular weight of 557.87 g/mol. Its IUPAC name is 1-chloro-4-methoxybenzene;methyl 4-[4-(2-amino-5-bromophenyl)-1-formyl-3,6-dihydro-2H-pyridin-6-yl]benzoate.
| Compound Name | 1-chloro-4-methoxybenzene;methyl 4-[4-(2-amino-5-bromophenyl)-1-formyl-3,6-dihydro-2H-pyridin-6-yl]benzoate |
|---|---|
| PubChem CID | 143536004 |
| Molecular Formula | C27H26BrClN2O4 |
| Molecular Weight | 557.87 g/mol |
| Exact Mass | 556.08 |
| IUPAC Name | 1-chloro-4-methoxybenzene;methyl 4-[4-(2-amino-5-bromophenyl)-1-formyl-3,6-dihydro-2H-pyridin-6-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2C=C(c3cc(Br)ccc3N)CCN2C=O)cc1.COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H19BrN2O3.C7H7ClO/c1-26-20(25)14-4-2-13(3-5-14)19-10-15(8-9-23(19)12-24)17-11-16(21)6-7-18(17)22;1-9-7-4-2-6(8)3-5-7/h2-7,10-12,19H,8-9,22H2,1H3;2-5H,1H3 |
| InChIKey | GFRYYBDQAQDTPM-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.87 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|