C20H19BrN2O2S — CID 143536177
methyl 4-[4-(2-amino-5-bromophenyl)-1-methanethioyl-3,6-dihydro-2H-pyridin-6-yl]benzoate (PubChem CID 143536177) has the molecular formula C20H19BrN2O2S and a molecular weight of 431.36 g/mol. Its IUPAC name is methyl 4-[4-(2-amino-5-bromophenyl)-1-methanethioyl-3,6-dihydro-2H-pyridin-6-yl]benzoate.
| Compound Name | methyl 4-[4-(2-amino-5-bromophenyl)-1-methanethioyl-3,6-dihydro-2H-pyridin-6-yl]benzoate |
|---|---|
| PubChem CID | 143536177 |
| Molecular Formula | C20H19BrN2O2S |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | methyl 4-[4-(2-amino-5-bromophenyl)-1-methanethioyl-3,6-dihydro-2H-pyridin-6-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2C=C(c3cc(Br)ccc3N)CCN2C=S)cc1 |
| InChI | InChI=1S/C20H19BrN2O2S/c1-25-20(24)14-4-2-13(3-5-14)19-10-15(8-9-23(19)12-26)17-11-16(21)6-7-18(17)22/h2-7,10-12,19H,8-9,22H2,1H3 |
| InChIKey | WICWBDSFLUJRTJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|