C29H35Cl2F3N6O2 — CID 146388152
tert-butyl N-[1-[[6-chloro-2-[2-[[5-chloro-6-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]methyl]pyrrolidin-3-yl]carbamate (PubChem CID 146388152) has the molecular formula C29H35Cl2F3N6O2 and a molecular weight of 627.54 g/mol. Its IUPAC name is tert-butyl N-[1-[[6-chloro-2-[2-[[5-chloro-6-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]methyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[6-chloro-2-[2-[[5-chloro-6-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]methyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 146388152 |
| Molecular Formula | C29H35Cl2F3N6O2 |
| Molecular Weight | 627.54 g/mol |
| Exact Mass | 626.22 |
| IUPAC Name | tert-butyl N-[1-[[6-chloro-2-[2-[[5-chloro-6-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]methyl]pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(CC2c3[nH]c4ccc(Cl)cc4c3CCN2CCNc2ccc(Cl)c(C(F)(F)F)n2)C1 |
| InChI | InChI=1S/C29H35Cl2F3N6O2/c1-28(2,3)42-27(41)36-18-8-11-39(15-18)16-23-25-19(20-14-17(30)4-6-22(20)37-25)9-12-40(23)13-10-35-24-7-5-21(31)26(38-24)29(32,33)34/h4-7,14,18,23,37H,8-13,15-16H2,1-3H3,(H,35,38)(H,36,41) |
| InChIKey | HBKCMKIIDYKPFD-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.54 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|