C19H21Cl2N5 — CID 146387782
3-chloro-6-N-[2-(6-chloro-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)ethyl]pyridine-2,6-diamine (PubChem CID 146387782) has the molecular formula C19H21Cl2N5 and a molecular weight of 390.32 g/mol. Its IUPAC name is 3-chloro-6-N-[2-(6-chloro-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)ethyl]pyridine-2,6-diamine.
| Compound Name | 3-chloro-6-N-[2-(6-chloro-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)ethyl]pyridine-2,6-diamine |
|---|---|
| PubChem CID | 146387782 |
| Molecular Formula | C19H21Cl2N5 |
| Molecular Weight | 390.32 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 3-chloro-6-N-[2-(6-chloro-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)ethyl]pyridine-2,6-diamine |
| SMILES | CC1c2[nH]c3ccc(Cl)cc3c2CCN1CCNc1ccc(Cl)c(N)n1 |
| InChI | InChI=1S/C19H21Cl2N5/c1-11-18-13(14-10-12(20)2-4-16(14)24-18)6-8-26(11)9-7-23-17-5-3-15(21)19(22)25-17/h2-5,10-11,24H,6-9H2,1H3,(H3,22,23,25) |
| InChIKey | MWSRCEFGCQCGTA-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.32 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|