C15H20Cl2N2O2 — CID 116637787
N-(2,5-dichlorophenyl)-2-[2-(hydroxymethyl)azepan-1-yl]acetamide (PubChem CID 116637787) has the molecular formula C15H20Cl2N2O2 and a molecular weight of 331.24 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-[2-(hydroxymethyl)azepan-1-yl]acetamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-[2-(hydroxymethyl)azepan-1-yl]acetamide |
|---|---|
| PubChem CID | 116637787 |
| Molecular Formula | C15H20Cl2N2O2 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-[2-(hydroxymethyl)azepan-1-yl]acetamide |
| SMILES | O=C(CN1CCCCCC1CO)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H20Cl2N2O2/c16-11-5-6-13(17)14(8-11)18-15(21)9-19-7-3-1-2-4-12(19)10-20/h5-6,8,12,20H,1-4,7,9-10H2,(H,18,21) |
| InChIKey | VPASEZHQCQLJFQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |