C17H23ClN2O4 — CID 60524285
methyl 2-[1-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]piperidin-2-yl]acetate (PubChem CID 60524285) has the molecular formula C17H23ClN2O4 and a molecular weight of 354.83 g/mol. Its IUPAC name is methyl 2-[1-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]piperidin-2-yl]acetate.
| Compound Name | methyl 2-[1-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]piperidin-2-yl]acetate |
|---|---|
| PubChem CID | 60524285 |
| Molecular Formula | C17H23ClN2O4 |
| Molecular Weight | 354.83 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | methyl 2-[1-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]piperidin-2-yl]acetate |
| SMILES | COC(=O)CC1CCCCN1CC(=O)Nc1cc(Cl)ccc1OC |
| InChI | InChI=1S/C17H23ClN2O4/c1-23-15-7-6-12(18)9-14(15)19-16(21)11-20-8-4-3-5-13(20)10-17(22)24-2/h6-7,9,13H,3-5,8,10-11H2,1-2H3,(H,19,21) |
| InChIKey | ZFAMDOQKVAIEMG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.83 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |