C16H20ClN3O5 — CID 8561617
methyl 2-[(2S)-1-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 8561617) has the molecular formula C16H20ClN3O5 and a molecular weight of 369.81 g/mol. Its IUPAC name is methyl 2-[(2S)-1-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | methyl 2-[(2S)-1-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 8561617 |
| Molecular Formula | C16H20ClN3O5 |
| Molecular Weight | 369.81 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | methyl 2-[(2S)-1-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | COC(=O)C[C@H]1C(=O)NCCN1CC(=O)Nc1cc(Cl)ccc1OC |
| InChI | InChI=1S/C16H20ClN3O5/c1-24-13-4-3-10(17)7-11(13)19-14(21)9-20-6-5-18-16(23)12(20)8-15(22)25-2/h3-4,7,12H,5-6,8-9H2,1-2H3,(H,18,23)(H,19,21)/t12-/m0/s1 |
| InChIKey | ABMNOELZXVAWNR-LBPRGKRZSA-N |
| XLogP | 0.65 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.81 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |