C20H27N3O4 — CID 51965662
methyl 2-[(2R)-1-[2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl]piperidin-2-yl]acetate (PubChem CID 51965662) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is methyl 2-[(2R)-1-[2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl]piperidin-2-yl]acetate.
| Compound Name | methyl 2-[(2R)-1-[2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl]piperidin-2-yl]acetate |
|---|---|
| PubChem CID | 51965662 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | methyl 2-[(2R)-1-[2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl]piperidin-2-yl]acetate |
| SMILES | COC(=O)C[C@H]1CCCCN1CC(=O)Nc1ccccc1C(=O)NC1CC1 |
| InChI | InChI=1S/C20H27N3O4/c1-27-19(25)12-15-6-4-5-11-23(15)13-18(24)22-17-8-3-2-7-16(17)20(26)21-14-9-10-14/h2-3,7-8,14-15H,4-6,9-13H2,1H3,(H,21,26)(H,22,24)/t15-/m1/s1 |
| InChIKey | HGGDEEAZEORMMH-OAHLLOKOSA-N |
| XLogP | 1.93 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |