C20H21Cl2N3O2 — CID 153405503
N-[(3-chloro-5-hydroxyphenyl)methyl]formamide;6-chloro-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 153405503) has the molecular formula C20H21Cl2N3O2 and a molecular weight of 406.31 g/mol. Its IUPAC name is N-[(3-chloro-5-hydroxyphenyl)methyl]formamide;6-chloro-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | N-[(3-chloro-5-hydroxyphenyl)methyl]formamide;6-chloro-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 153405503 |
| Molecular Formula | C20H21Cl2N3O2 |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | N-[(3-chloro-5-hydroxyphenyl)methyl]formamide;6-chloro-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CN1CCc2c([nH]c3ccc(Cl)cc23)C1.O=CNCc1cc(O)cc(Cl)c1 |
| InChI | InChI=1S/C12H13ClN2.C8H8ClNO2/c1-15-5-4-9-10-6-8(13)2-3-11(10)14-12(9)7-15;9-7-1-6(4-10-5-11)2-8(12)3-7/h2-3,6,14H,4-5,7H2,1H3;1-3,5,12H,4H2,(H,10,11) |
| InChIKey | VWVVHFHJIBOJMW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|