C19H17Cl2N3O4S — CID 146388025
methyl 6-chloro-2-[(3-chlorophenyl)sulfamoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-4-carboxylate (PubChem CID 146388025) has the molecular formula C19H17Cl2N3O4S and a molecular weight of 454.34 g/mol. Its IUPAC name is methyl 6-chloro-2-[(3-chlorophenyl)sulfamoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-4-carboxylate.
| Compound Name | methyl 6-chloro-2-[(3-chlorophenyl)sulfamoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-4-carboxylate |
|---|---|
| PubChem CID | 146388025 |
| Molecular Formula | C19H17Cl2N3O4S |
| Molecular Weight | 454.34 g/mol |
| Exact Mass | 453.03 |
| IUPAC Name | methyl 6-chloro-2-[(3-chlorophenyl)sulfamoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-4-carboxylate |
| SMILES | COC(=O)C1CN(S(=O)(=O)Nc2cccc(Cl)c2)Cc2[nH]c3ccc(Cl)cc3c21 |
| InChI | InChI=1S/C19H17Cl2N3O4S/c1-28-19(25)15-9-24(29(26,27)23-13-4-2-3-11(20)7-13)10-17-18(15)14-8-12(21)5-6-16(14)22-17/h2-8,15,22-23H,9-10H2,1H3 |
| InChIKey | LCFSOFNMLWMAQI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|