C12H16ClN3O4S — CID 126508192
4-[(3-chlorophenyl)sulfamoyl]-2-methylpiperazine-1-carboxylic acid (PubChem CID 126508192) has the molecular formula C12H16ClN3O4S and a molecular weight of 333.80 g/mol. Its IUPAC name is 4-[(3-chlorophenyl)sulfamoyl]-2-methylpiperazine-1-carboxylic acid.
| Compound Name | 4-[(3-chlorophenyl)sulfamoyl]-2-methylpiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 126508192 |
| Molecular Formula | C12H16ClN3O4S |
| Molecular Weight | 333.80 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 4-[(3-chlorophenyl)sulfamoyl]-2-methylpiperazine-1-carboxylic acid |
| SMILES | CC1CN(S(=O)(=O)Nc2cccc(Cl)c2)CCN1C(=O)O |
| InChI | InChI=1S/C12H16ClN3O4S/c1-9-8-15(5-6-16(9)12(17)18)21(19,20)14-11-4-2-3-10(13)7-11/h2-4,7,9,14H,5-6,8H2,1H3,(H,17,18) |
| InChIKey | UVJCMZIREIVPKE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.80 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |