C16H24N2O4S — CID 138023492
1-[(2R)-4-ethylsulfonyl-2-methylpiperazin-1-yl]-2-(3-hydroxyphenyl)propan-1-one (PubChem CID 138023492) has the molecular formula C16H24N2O4S and a molecular weight of 340.45 g/mol. Its IUPAC name is 1-[(2R)-4-ethylsulfonyl-2-methylpiperazin-1-yl]-2-(3-hydroxyphenyl)propan-1-one.
| Compound Name | 1-[(2R)-4-ethylsulfonyl-2-methylpiperazin-1-yl]-2-(3-hydroxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 138023492 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 1-[(2R)-4-ethylsulfonyl-2-methylpiperazin-1-yl]-2-(3-hydroxyphenyl)propan-1-one |
| SMILES | CCS(=O)(=O)N1CCN(C(=O)C(C)c2cccc(O)c2)[C@H](C)C1 |
| InChI | InChI=1S/C16H24N2O4S/c1-4-23(21,22)17-8-9-18(12(2)11-17)16(20)13(3)14-6-5-7-15(19)10-14/h5-7,10,12-13,19H,4,8-9,11H2,1-3H3/t12-,13?/m1/s1 |
| InChIKey | DNTFVDYAUQYCMK-PZORYLMUSA-N |
| XLogP | 1.38 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |