C17H28N2O3S — CID 98792461
3-[(1R)-1-[ethyl-[[(3S)-1-methylsulfonylpiperidin-3-yl]methyl]amino]ethyl]phenol (PubChem CID 98792461) has the molecular formula C17H28N2O3S and a molecular weight of 340.49 g/mol. Its IUPAC name is 3-[(1R)-1-[ethyl-[[(3S)-1-methylsulfonylpiperidin-3-yl]methyl]amino]ethyl]phenol.
| Compound Name | 3-[(1R)-1-[ethyl-[[(3S)-1-methylsulfonylpiperidin-3-yl]methyl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 98792461 |
| Molecular Formula | C17H28N2O3S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 3-[(1R)-1-[ethyl-[[(3S)-1-methylsulfonylpiperidin-3-yl]methyl]amino]ethyl]phenol |
| SMILES | CCN(C[C@@H]1CCCN(S(C)(=O)=O)C1)[C@H](C)c1cccc(O)c1 |
| InChI | InChI=1S/C17H28N2O3S/c1-4-18(14(2)16-8-5-9-17(20)11-16)12-15-7-6-10-19(13-15)23(3,21)22/h5,8-9,11,14-15,20H,4,6-7,10,12-13H2,1-3H3/t14-,15+/m1/s1 |
| InChIKey | JMAXQRQZIFFCDA-CABCVRRESA-N |
| XLogP | 2.45 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |