C16H32N2O3S — CID 84595718
2-[(1-methylsulfonylpiperidin-3-yl)methyl-propan-2-ylamino]cyclohexan-1-ol (PubChem CID 84595718) has the molecular formula C16H32N2O3S and a molecular weight of 332.51 g/mol. Its IUPAC name is 2-[(1-methylsulfonylpiperidin-3-yl)methyl-propan-2-ylamino]cyclohexan-1-ol.
| Compound Name | 2-[(1-methylsulfonylpiperidin-3-yl)methyl-propan-2-ylamino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 84595718 |
| Molecular Formula | C16H32N2O3S |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 2-[(1-methylsulfonylpiperidin-3-yl)methyl-propan-2-ylamino]cyclohexan-1-ol |
| SMILES | CC(C)N(CC1CCCN(S(C)(=O)=O)C1)C1CCCCC1O |
| InChI | InChI=1S/C16H32N2O3S/c1-13(2)18(15-8-4-5-9-16(15)19)12-14-7-6-10-17(11-14)22(3,20)21/h13-16,19H,4-12H2,1-3H3 |
| InChIKey | IRYVKQPJWVWHGZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |