C13H27N3O4S — CID 107425042
2-[2-(dimethylamino)ethyl-[(1-methylsulfonylpiperidin-3-yl)methyl]amino]acetic acid (PubChem CID 107425042) has the molecular formula C13H27N3O4S and a molecular weight of 321.44 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethyl-[(1-methylsulfonylpiperidin-3-yl)methyl]amino]acetic acid.
| Compound Name | 2-[2-(dimethylamino)ethyl-[(1-methylsulfonylpiperidin-3-yl)methyl]amino]acetic acid |
|---|---|
| PubChem CID | 107425042 |
| Molecular Formula | C13H27N3O4S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 2-[2-(dimethylamino)ethyl-[(1-methylsulfonylpiperidin-3-yl)methyl]amino]acetic acid |
| SMILES | CN(C)CCN(CC(=O)O)CC1CCCN(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C13H27N3O4S/c1-14(2)7-8-15(11-13(17)18)9-12-5-4-6-16(10-12)21(3,19)20/h12H,4-11H2,1-3H3,(H,17,18) |
| InChIKey | OBWKTFZQVDYDQT-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |