C12H25ClN2O2S — CID 79622478
N-(2-chloroethyl)-N-[(1-methylsulfonylpiperidin-3-yl)methyl]propan-1-amine (PubChem CID 79622478) has the molecular formula C12H25ClN2O2S and a molecular weight of 296.86 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-[(1-methylsulfonylpiperidin-3-yl)methyl]propan-1-amine.
| Compound Name | N-(2-chloroethyl)-N-[(1-methylsulfonylpiperidin-3-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 79622478 |
| Molecular Formula | C12H25ClN2O2S |
| Molecular Weight | 296.86 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | N-(2-chloroethyl)-N-[(1-methylsulfonylpiperidin-3-yl)methyl]propan-1-amine |
| SMILES | CCCN(CCCl)CC1CCCN(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C12H25ClN2O2S/c1-3-7-14(9-6-13)10-12-5-4-8-15(11-12)18(2,16)17/h12H,3-11H2,1-2H3 |
| InChIKey | UEGRRGYFKWEJFJ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.86 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|