C11H21N3O2S — CID 113249300
3-[methyl-[(1-methylsulfonylpiperidin-3-yl)methyl]amino]propanenitrile (PubChem CID 113249300) has the molecular formula C11H21N3O2S and a molecular weight of 259.37 g/mol. Its IUPAC name is 3-[methyl-[(1-methylsulfonylpiperidin-3-yl)methyl]amino]propanenitrile.
| Compound Name | 3-[methyl-[(1-methylsulfonylpiperidin-3-yl)methyl]amino]propanenitrile |
|---|---|
| PubChem CID | 113249300 |
| Molecular Formula | C11H21N3O2S |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 3-[methyl-[(1-methylsulfonylpiperidin-3-yl)methyl]amino]propanenitrile |
| SMILES | CN(CCC#N)CC1CCCN(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C11H21N3O2S/c1-13(7-4-6-12)9-11-5-3-8-14(10-11)17(2,15)16/h11H,3-5,7-10H2,1-2H3 |
| InChIKey | LWDRKSLKVPKUCT-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |