C13H28N2O3S — CID 115278735
1-[ethyl-[(1-methylsulfonylpiperidin-3-yl)methyl]amino]-2-methylpropan-2-ol (PubChem CID 115278735) has the molecular formula C13H28N2O3S and a molecular weight of 292.44 g/mol. Its IUPAC name is 1-[ethyl-[(1-methylsulfonylpiperidin-3-yl)methyl]amino]-2-methylpropan-2-ol.
| Compound Name | 1-[ethyl-[(1-methylsulfonylpiperidin-3-yl)methyl]amino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 115278735 |
| Molecular Formula | C13H28N2O3S |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 1-[ethyl-[(1-methylsulfonylpiperidin-3-yl)methyl]amino]-2-methylpropan-2-ol |
| SMILES | CCN(CC1CCCN(S(C)(=O)=O)C1)CC(C)(C)O |
| InChI | InChI=1S/C13H28N2O3S/c1-5-14(11-13(2,3)16)9-12-7-6-8-15(10-12)19(4,17)18/h12,16H,5-11H2,1-4H3 |
| InChIKey | XWZOBXCBGOAFPS-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |