C14H30N2O3S — CID 79610035
3-(dimethylamino)-3-methyl-1-(1-methylsulfonylpiperidin-3-yl)pentan-2-ol (PubChem CID 79610035) has the molecular formula C14H30N2O3S and a molecular weight of 306.47 g/mol. Its IUPAC name is 3-(dimethylamino)-3-methyl-1-(1-methylsulfonylpiperidin-3-yl)pentan-2-ol.
| Compound Name | 3-(dimethylamino)-3-methyl-1-(1-methylsulfonylpiperidin-3-yl)pentan-2-ol |
|---|---|
| PubChem CID | 79610035 |
| Molecular Formula | C14H30N2O3S |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | 3-(dimethylamino)-3-methyl-1-(1-methylsulfonylpiperidin-3-yl)pentan-2-ol |
| SMILES | CCC(C)(C(O)CC1CCCN(S(C)(=O)=O)C1)N(C)C |
| InChI | InChI=1S/C14H30N2O3S/c1-6-14(2,15(3)4)13(17)10-12-8-7-9-16(11-12)20(5,18)19/h12-13,17H,6-11H2,1-5H3 |
| InChIKey | WRWZQJLFSDBGNC-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |