C18H17Cl2N3OS — CID 153405474
[6-chloro-2-(3-chloroanilino)sulfanyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-4-yl]methanol (PubChem CID 153405474) has the molecular formula C18H17Cl2N3OS and a molecular weight of 394.33 g/mol. Its IUPAC name is [6-chloro-2-(3-chloroanilino)sulfanyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-4-yl]methanol.
| Compound Name | [6-chloro-2-(3-chloroanilino)sulfanyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-4-yl]methanol |
|---|---|
| PubChem CID | 153405474 |
| Molecular Formula | C18H17Cl2N3OS |
| Molecular Weight | 394.33 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | [6-chloro-2-(3-chloroanilino)sulfanyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-4-yl]methanol |
| SMILES | OCC1CN(SNc2cccc(Cl)c2)Cc2[nH]c3ccc(Cl)cc3c21 |
| InChI | InChI=1S/C18H17Cl2N3OS/c19-12-2-1-3-14(6-12)22-25-23-8-11(10-24)18-15-7-13(20)4-5-16(15)21-17(18)9-23/h1-7,11,21-22,24H,8-10H2 |
| InChIKey | JKXUNHNKRHLKRX-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 51.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.33 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|