C21H18ClF3N2O — CID 162029795
1-(6-chloro-4-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-2-[4-(trifluoromethyl)phenyl]ethanone (PubChem CID 162029795) has the molecular formula C21H18ClF3N2O and a molecular weight of 406.84 g/mol. Its IUPAC name is 1-(6-chloro-4-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-2-[4-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 1-(6-chloro-4-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-2-[4-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 162029795 |
| Molecular Formula | C21H18ClF3N2O |
| Molecular Weight | 406.84 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 1-(6-chloro-4-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-2-[4-(trifluoromethyl)phenyl]ethanone |
| SMILES | CC1CN(C(=O)Cc2ccc(C(F)(F)F)cc2)Cc2[nH]c3ccc(Cl)cc3c21 |
| InChI | InChI=1S/C21H18ClF3N2O/c1-12-10-27(11-18-20(12)16-9-15(22)6-7-17(16)26-18)19(28)8-13-2-4-14(5-3-13)21(23,24)25/h2-7,9,12,26H,8,10-11H2,1H3 |
| InChIKey | LDEPDXGJVIHKDN-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.84 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|