C17H21N3O3 — CID 130265629
N-acetyl-6-methoxy-N,4-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide (PubChem CID 130265629) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is N-acetyl-6-methoxy-N,4-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide.
| Compound Name | N-acetyl-6-methoxy-N,4-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 130265629 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N-acetyl-6-methoxy-N,4-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
| SMILES | COc1ccc2[nH]c3c(c2c1)C(C)CN(C(=O)N(C)C(C)=O)C3 |
| InChI | InChI=1S/C17H21N3O3/c1-10-8-20(17(22)19(3)11(2)21)9-15-16(10)13-7-12(23-4)5-6-14(13)18-15/h5-7,10,18H,8-9H2,1-4H3 |
| InChIKey | GLTZGOIAFITADM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|