C14H15NO4 — CID 84638532
4-hydroxy-6-methoxy-2,3,4,9-tetrahydro-1H-carbazole-2-carboxylic acid (PubChem CID 84638532) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is 4-hydroxy-6-methoxy-2,3,4,9-tetrahydro-1H-carbazole-2-carboxylic acid.
| Compound Name | 4-hydroxy-6-methoxy-2,3,4,9-tetrahydro-1H-carbazole-2-carboxylic acid |
|---|---|
| PubChem CID | 84638532 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 4-hydroxy-6-methoxy-2,3,4,9-tetrahydro-1H-carbazole-2-carboxylic acid |
| SMILES | COc1ccc2[nH]c3c(c2c1)C(O)CC(C(=O)O)C3 |
| InChI | InChI=1S/C14H15NO4/c1-19-8-2-3-10-9(6-8)13-11(15-10)4-7(14(17)18)5-12(13)16/h2-3,6-7,12,15-16H,4-5H2,1H3,(H,17,18) |
| InChIKey | UJFNMHKVEGPQEE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|