C15H19NO2 — CID 65333336
6-methoxy-2,2-dimethyl-1,3,4,9-tetrahydrocarbazol-4-ol (PubChem CID 65333336) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 6-methoxy-2,2-dimethyl-1,3,4,9-tetrahydrocarbazol-4-ol.
| Compound Name | 6-methoxy-2,2-dimethyl-1,3,4,9-tetrahydrocarbazol-4-ol |
|---|---|
| PubChem CID | 65333336 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 6-methoxy-2,2-dimethyl-1,3,4,9-tetrahydrocarbazol-4-ol |
| SMILES | COc1ccc2[nH]c3c(c2c1)C(O)CC(C)(C)C3 |
| InChI | InChI=1S/C15H19NO2/c1-15(2)7-12-14(13(17)8-15)10-6-9(18-3)4-5-11(10)16-12/h4-6,13,16-17H,7-8H2,1-3H3 |
| InChIKey | WHGBKGPGGBUUCT-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 45.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|