C13H15ClN2O3 — CID 140799634
6-methoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-4-carboxylic acid;hydrochloride (PubChem CID 140799634) has the molecular formula C13H15ClN2O3 and a molecular weight of 282.73 g/mol. Its IUPAC name is 6-methoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-4-carboxylic acid;hydrochloride.
| Compound Name | 6-methoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-4-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 140799634 |
| Molecular Formula | C13H15ClN2O3 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 6-methoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-4-carboxylic acid;hydrochloride |
| SMILES | COc1ccc2[nH]c3c(c2c1)C(C(=O)O)CNC3.Cl |
| InChI | InChI=1S/C13H14N2O3.ClH/c1-18-7-2-3-10-8(4-7)12-9(13(16)17)5-14-6-11(12)15-10;/h2-4,9,14-15H,5-6H2,1H3,(H,16,17);1H |
| InChIKey | DQNBANXKZZMBEM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|